C25H20N4O3S2 — CID 70368763
1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-3-(1,3-thiazol-2-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 70368763) has the molecular formula C25H20N4O3S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is 1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-3-(1,3-thiazol-2-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-3-(1,3-thiazol-2-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 70368763 |
| Molecular Formula | C25H20N4O3S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-3-(1,3-thiazol-2-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N(C2c3ccccc3CSc3ccccc32)CN1Cc1nccs1 |
| InChI | InChI=1S/C25H20N4O3S2/c30-19-9-11-28-23(24(19)31)25(32)27(13-21-26-10-12-33-21)15-29(28)22-17-6-2-1-5-16(17)14-34-20-8-4-3-7-18(20)22/h1-12,22,31H,13-15H2 |
| InChIKey | CTZSPSDGXMPEEG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |