C28H25N3O4S — CID 167027981
3-(2-cyclopropylethyl)-1-[(11S)-10-ethynoxy-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 167027981) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is 3-(2-cyclopropylethyl)-1-[(11S)-10-ethynoxy-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 3-(2-cyclopropylethyl)-1-[(11S)-10-ethynoxy-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 167027981 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 3-(2-cyclopropylethyl)-1-[(11S)-10-ethynoxy-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | C#COc1cccc2c1[C@H](N1CN(CCC3CC3)C(=O)c3c(O)c(=O)ccn31)c1ccccc1SC2 |
| InChI | InChI=1S/C28H25N3O4S/c1-2-35-22-8-5-6-19-16-36-23-9-4-3-7-20(23)25(24(19)22)31-17-29(14-12-18-10-11-18)28(34)26-27(33)21(32)13-15-30(26)31/h1,3-9,13,15,18,25,33H,10-12,14,16-17H2/t25-/m1/s1 |
| InChIKey | OIGDLJQKQJWIGD-RUZDIDTESA-N |
| XLogP | 4.07 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|