C35H33N3O4S — CID 156901067
3-but-3-enyl-5-phenylmethoxy-1-(10-prop-2-enoxy-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 156901067) has the molecular formula C35H33N3O4S and a molecular weight of 591.73 g/mol. Its IUPAC name is 3-but-3-enyl-5-phenylmethoxy-1-(10-prop-2-enoxy-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 3-but-3-enyl-5-phenylmethoxy-1-(10-prop-2-enoxy-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 156901067 |
| Molecular Formula | C35H33N3O4S |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | 3-but-3-enyl-5-phenylmethoxy-1-(10-prop-2-enoxy-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | C=CCCN1CN(C2c3ccccc3SCc3cccc(OCC=C)c32)n2ccc(=O)c(OCc3ccccc3)c2C1=O |
| InChI | InChI=1S/C35H33N3O4S/c1-3-5-19-36-24-38(37-20-18-28(39)34(33(37)35(36)40)42-22-25-12-7-6-8-13-25)32-27-15-9-10-17-30(27)43-23-26-14-11-16-29(31(26)32)41-21-4-2/h3-4,6-18,20,32H,1-2,5,19,21-24H2 |
| InChIKey | GVVSQVQQEYJKIM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|