C31H26ClN3O4 — CID 148855112
(11Z)-7-chloro-2-phenyl-17-phenylmethoxy-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione (PubChem CID 148855112) has the molecular formula C31H26ClN3O4 and a molecular weight of 540.02 g/mol. Its IUPAC name is (11Z)-7-chloro-2-phenyl-17-phenylmethoxy-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione.
| Compound Name | (11Z)-7-chloro-2-phenyl-17-phenylmethoxy-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
|---|---|
| PubChem CID | 148855112 |
| Molecular Formula | C31H26ClN3O4 |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | (11Z)-7-chloro-2-phenyl-17-phenylmethoxy-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
| SMILES | O=C1c2c(OCc3ccccc3)c(=O)ccn2N2CN1C/C=C\COc1c(Cl)cccc1C2c1ccccc1 |
| InChI | InChI=1S/C31H26ClN3O4/c32-25-15-9-14-24-27(23-12-5-2-6-13-23)35-21-33(17-7-8-19-38-29(24)25)31(37)28-30(26(36)16-18-34(28)35)39-20-22-10-3-1-4-11-22/h1-16,18,27H,17,19-21H2/b8-7- |
| InChIKey | OYFDCILEQZAPRI-FPLPWBNLSA-N |
| XLogP | 5.17 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|