C30H25FN4O4 — CID 164741396
(2R,11Z)-6-fluoro-17-phenylmethoxy-2-pyridin-2-yl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione (PubChem CID 164741396) has the molecular formula C30H25FN4O4 and a molecular weight of 524.55 g/mol. Its IUPAC name is (2R,11Z)-6-fluoro-17-phenylmethoxy-2-pyridin-2-yl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione.
| Compound Name | (2R,11Z)-6-fluoro-17-phenylmethoxy-2-pyridin-2-yl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
|---|---|
| PubChem CID | 164741396 |
| Molecular Formula | C30H25FN4O4 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | (2R,11Z)-6-fluoro-17-phenylmethoxy-2-pyridin-2-yl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
| SMILES | O=C1c2c(OCc3ccccc3)c(=O)ccn2N2CN1C/C=C\COc1cc(F)ccc1[C@@H]2c1ccccn1 |
| InChI | InChI=1S/C30H25FN4O4/c31-22-11-12-23-26(18-22)38-17-7-6-15-33-20-35(27(23)24-10-4-5-14-32-24)34-16-13-25(36)29(28(34)30(33)37)39-19-21-8-2-1-3-9-21/h1-14,16,18,27H,15,17,19-20H2/b7-6-/t27-/m1/s1 |
| InChIKey | ORBORIGBEABXLG-HEAQOHGTSA-N |
| XLogP | 4.05 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|