C24H22N4O4 — CID 164607542
(10E)-18-hydroxy-2-pyridin-2-yl-9-oxa-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,10,17,20-hexaene-16,19-dione (PubChem CID 164607542) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is (10E)-18-hydroxy-2-pyridin-2-yl-9-oxa-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,10,17,20-hexaene-16,19-dione.
| Compound Name | (10E)-18-hydroxy-2-pyridin-2-yl-9-oxa-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,10,17,20-hexaene-16,19-dione |
|---|---|
| PubChem CID | 164607542 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (10E)-18-hydroxy-2-pyridin-2-yl-9-oxa-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,10,17,20-hexaene-16,19-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N2CN1CCC/C=C/Oc1ccccc1C2c1ccccn1 |
| InChI | InChI=1S/C24H22N4O4/c29-19-11-14-27-22(23(19)30)24(31)26-13-6-1-7-15-32-20-10-3-2-8-17(20)21(28(27)16-26)18-9-4-5-12-25-18/h2-5,7-12,14-15,21,30H,1,6,13,16H2/b15-7+ |
| InChIKey | CXFSUIXTLAQRKF-VIZOYTHASA-N |
| XLogP | 2.78 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |