C24H23N3O4 — CID 152934986
(2R)-17-hydroxy-2-phenyl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3,5,7,16,19-pentaene-15,18-dione (PubChem CID 152934986) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is (2R)-17-hydroxy-2-phenyl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3,5,7,16,19-pentaene-15,18-dione.
| Compound Name | (2R)-17-hydroxy-2-phenyl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3,5,7,16,19-pentaene-15,18-dione |
|---|---|
| PubChem CID | 152934986 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (2R)-17-hydroxy-2-phenyl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3,5,7,16,19-pentaene-15,18-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N2CN1CCCCOc1ccccc1[C@H]2c1ccccc1 |
| InChI | InChI=1S/C24H23N3O4/c28-19-12-14-26-22(23(19)29)24(30)25-13-6-7-15-31-20-11-5-4-10-18(20)21(27(26)16-25)17-8-2-1-3-9-17/h1-5,8-12,14,21,29H,6-7,13,15-16H2/t21-/m1/s1 |
| InChIKey | ULRQLTPISBZZDX-OAQYLSRUSA-N |
| XLogP | 2.87 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |