C28H31N3O3 — CID 166563800
18-hydroxy-11,11-dimethyl-2-phenyl-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,17,20-pentaene-16,19-dione (PubChem CID 166563800) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is 18-hydroxy-11,11-dimethyl-2-phenyl-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,17,20-pentaene-16,19-dione.
| Compound Name | 18-hydroxy-11,11-dimethyl-2-phenyl-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,17,20-pentaene-16,19-dione |
|---|---|
| PubChem CID | 166563800 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 18-hydroxy-11,11-dimethyl-2-phenyl-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,17,20-pentaene-16,19-dione |
| SMILES | CC1(C)CCCN2CN(C(c3ccccc3)c3ccccc3CC1)n1ccc(=O)c(O)c1C2=O |
| InChI | InChI=1S/C28H31N3O3/c1-28(2)15-8-17-29-19-31(30-18-14-23(32)26(33)25(30)27(29)34)24(21-10-4-3-5-11-21)22-12-7-6-9-20(22)13-16-28/h3-7,9-12,14,18,24,33H,8,13,15-17,19H2,1-2H3 |
| InChIKey | ZZGWIVZAKYPPSI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |