C32H29N3O4 — CID 164741366
(2R,11E)-2-phenyl-18-phenylmethoxy-9-oxa-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,11,17,20-hexaene-16,19-dione (PubChem CID 164741366) has the molecular formula C32H29N3O4 and a molecular weight of 519.60 g/mol. Its IUPAC name is (2R,11E)-2-phenyl-18-phenylmethoxy-9-oxa-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,11,17,20-hexaene-16,19-dione.
| Compound Name | (2R,11E)-2-phenyl-18-phenylmethoxy-9-oxa-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,11,17,20-hexaene-16,19-dione |
|---|---|
| PubChem CID | 164741366 |
| Molecular Formula | C32H29N3O4 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | (2R,11E)-2-phenyl-18-phenylmethoxy-9-oxa-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,11,17,20-hexaene-16,19-dione |
| SMILES | O=C1c2c(OCc3ccccc3)c(=O)ccn2N2CN1CC/C=C/COc1ccccc1[C@H]2c1ccccc1 |
| InChI | InChI=1S/C32H29N3O4/c36-27-18-20-34-30(31(27)39-22-24-12-4-1-5-13-24)32(37)33-19-10-3-11-21-38-28-17-9-8-16-26(28)29(35(34)23-33)25-14-6-2-7-15-25/h1-9,11-18,20,29H,10,19,21-23H2/b11-3+/t29-/m1/s1 |
| InChIKey | ULGBSUYTBBNXEE-PXBHBUAGSA-N |
| XLogP | 4.91 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|