C31H28N4O3 — CID 164741385
(2R,11Z)-2-phenyl-17-phenylmethoxy-1,6,14,21-tetrazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione (PubChem CID 164741385) has the molecular formula C31H28N4O3 and a molecular weight of 504.59 g/mol. Its IUPAC name is (2R,11Z)-2-phenyl-17-phenylmethoxy-1,6,14,21-tetrazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione.
| Compound Name | (2R,11Z)-2-phenyl-17-phenylmethoxy-1,6,14,21-tetrazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
|---|---|
| PubChem CID | 164741385 |
| Molecular Formula | C31H28N4O3 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | (2R,11Z)-2-phenyl-17-phenylmethoxy-1,6,14,21-tetrazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
| SMILES | O=C1c2c(OCc3ccccc3)c(=O)ccn2N2CN1C/C=C\CCc1cnccc1[C@H]2c1ccccc1 |
| InChI | InChI=1S/C31H28N4O3/c36-27-16-19-34-29(30(27)38-21-23-10-4-1-5-11-23)31(37)33-18-9-3-8-14-25-20-32-17-15-26(25)28(35(34)22-33)24-12-6-2-7-13-24/h1-7,9-13,15-17,19-20,28H,8,14,18,21-22H2/b9-3-/t28-/m1/s1 |
| InChIKey | MKTIKBLQIFRRCO-FBRUBFJNSA-N |
| XLogP | 4.47 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|