C24H21FN4O3 — CID 172970410
(11Z)-6-fluoro-17-hydroxy-2-phenyl-1,14,20,21-tetrazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione (PubChem CID 172970410) has the molecular formula C24H21FN4O3 and a molecular weight of 432.46 g/mol. Its IUPAC name is (11Z)-6-fluoro-17-hydroxy-2-phenyl-1,14,20,21-tetrazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione.
| Compound Name | (11Z)-6-fluoro-17-hydroxy-2-phenyl-1,14,20,21-tetrazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
|---|---|
| PubChem CID | 172970410 |
| Molecular Formula | C24H21FN4O3 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (11Z)-6-fluoro-17-hydroxy-2-phenyl-1,14,20,21-tetrazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
| SMILES | O=C1c2c(O)c(=O)cnn2N2CN1C/C=C\CCc1cc(F)ccc1C2c1ccccc1 |
| InChI | InChI=1S/C24H21FN4O3/c25-18-10-11-19-17(13-18)9-5-2-6-12-27-15-28(21(19)16-7-3-1-4-8-16)29-22(24(27)32)23(31)20(30)14-26-29/h1-4,6-8,10-11,13-14,21,31H,5,9,12,15H2/b6-2- |
| InChIKey | YZRVTWCGCHNKAR-KXFIGUGUSA-N |
| XLogP | 2.73 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|