C26H27N3O3 — CID 167028139
(11E)-18,19-dihydroxy-2-phenyl-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,11,17,20-hexaen-16-one (PubChem CID 167028139) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is (11E)-18,19-dihydroxy-2-phenyl-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,11,17,20-hexaen-16-one.
| Compound Name | (11E)-18,19-dihydroxy-2-phenyl-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,11,17,20-hexaen-16-one |
|---|---|
| PubChem CID | 167028139 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (11E)-18,19-dihydroxy-2-phenyl-1,15,22-triazatetracyclo[13.7.1.03,8.017,22]tricosa-3,5,7,11,17,20-hexaen-16-one |
| SMILES | O=C1C2=C(O)C(O)C=CN2N2CN1CC/C=C/CCc1ccccc1C2c1ccccc1 |
| InChI | InChI=1S/C26H27N3O3/c30-22-15-17-28-24(25(22)31)26(32)27-16-9-2-1-4-10-19-11-7-8-14-21(19)23(29(28)18-27)20-12-5-3-6-13-20/h1-3,5-8,11-15,17,22-23,30-31H,4,9-10,16,18H2/b2-1+ |
| InChIKey | CEQICTCVDFSVFO-OWOJBTEDSA-N |
| XLogP | 3.64 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|