C26H27N3O4 — CID 167283427
(2R,12E)-19,20-dihydroxy-2-phenyl-9-oxa-1,16,23-triazatetracyclo[14.7.1.03,8.018,23]tetracosa-3,5,7,12,18,21-hexaen-17-one (PubChem CID 167283427) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is (2R,12E)-19,20-dihydroxy-2-phenyl-9-oxa-1,16,23-triazatetracyclo[14.7.1.03,8.018,23]tetracosa-3,5,7,12,18,21-hexaen-17-one.
| Compound Name | (2R,12E)-19,20-dihydroxy-2-phenyl-9-oxa-1,16,23-triazatetracyclo[14.7.1.03,8.018,23]tetracosa-3,5,7,12,18,21-hexaen-17-one |
|---|---|
| PubChem CID | 167283427 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | (2R,12E)-19,20-dihydroxy-2-phenyl-9-oxa-1,16,23-triazatetracyclo[14.7.1.03,8.018,23]tetracosa-3,5,7,12,18,21-hexaen-17-one |
| SMILES | O=C1C2=C(O)C(O)C=CN2N2CN1CC/C=C/CCOc1ccccc1[C@H]2c1ccccc1 |
| InChI | InChI=1S/C26H27N3O4/c30-21-14-16-28-24(25(21)31)26(32)27-15-8-1-2-9-17-33-22-13-7-6-12-20(22)23(29(28)18-27)19-10-4-3-5-11-19/h1-7,10-14,16,21,23,30-31H,8-9,15,17-18H2/b2-1+/t21?,23-/m1/s1 |
| InChIKey | DYCBANWXKOWVHJ-FGJFTOSGSA-N |
| XLogP | 3.48 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|