C34H37N3O3 — CID 167283055
(16E,21Z)-13-methyl-2-phenyl-17-phenylmethoxy-19-oxa-1,14,23-triazatetracyclo[12.9.1.03,8.016,23]tetracosa-3,5,7,16,21-pentaen-15-one (PubChem CID 167283055) has the molecular formula C34H37N3O3 and a molecular weight of 535.69 g/mol. Its IUPAC name is (16E,21Z)-13-methyl-2-phenyl-17-phenylmethoxy-19-oxa-1,14,23-triazatetracyclo[12.9.1.03,8.016,23]tetracosa-3,5,7,16,21-pentaen-15-one.
| Compound Name | (16E,21Z)-13-methyl-2-phenyl-17-phenylmethoxy-19-oxa-1,14,23-triazatetracyclo[12.9.1.03,8.016,23]tetracosa-3,5,7,16,21-pentaen-15-one |
|---|---|
| PubChem CID | 167283055 |
| Molecular Formula | C34H37N3O3 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | (16E,21Z)-13-methyl-2-phenyl-17-phenylmethoxy-19-oxa-1,14,23-triazatetracyclo[12.9.1.03,8.016,23]tetracosa-3,5,7,16,21-pentaen-15-one |
| SMILES | CC1CCCCc2ccccc2C(c2ccccc2)N2CN1C(=O)/C1=C(\OCc3ccccc3)COC/C=C\N12 |
| InChI | InChI=1S/C34H37N3O3/c1-26-13-8-9-16-28-17-10-11-20-30(28)32(29-18-6-3-7-19-29)37-25-35(26)34(38)33-31(24-39-22-12-21-36(33)37)40-23-27-14-4-2-5-15-27/h2-7,10-12,14-15,17-21,26,32H,8-9,13,16,22-25H2,1H3/b21-12-,33-31+ |
| InChIKey | NFGNCBCTUNALBP-PKECIGGVSA-N |
| XLogP | 6.18 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |