C23H36O — CID 68819057
3-methyl-1-phenylmethoxycyclopentadecene (PubChem CID 68819057) has the molecular formula C23H36O and a molecular weight of 328.54 g/mol. Its IUPAC name is 3-methyl-1-phenylmethoxycyclopentadecene.
| Compound Name | 3-methyl-1-phenylmethoxycyclopentadecene |
|---|---|
| PubChem CID | 68819057 |
| Molecular Formula | C23H36O |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | 3-methyl-1-phenylmethoxycyclopentadecene |
| SMILES | CC1C=C(OCc2ccccc2)CCCCCCCCCCCC1 |
| InChI | InChI=1S/C23H36O/c1-21-15-11-8-6-4-2-3-5-7-9-14-18-23(19-21)24-20-22-16-12-10-13-17-22/h10,12-13,16-17,19,21H,2-9,11,14-15,18,20H2,1H3 |
| InChIKey | AKAACJDXYAZYHJ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |