C18H18O2 — CID 146166263
(6S)-6-phenyl-4-phenylmethoxy-3,6-dihydro-2H-pyran (PubChem CID 146166263) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (6S)-6-phenyl-4-phenylmethoxy-3,6-dihydro-2H-pyran.
| Compound Name | (6S)-6-phenyl-4-phenylmethoxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 146166263 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (6S)-6-phenyl-4-phenylmethoxy-3,6-dihydro-2H-pyran |
| SMILES | C1=C(OCc2ccccc2)CCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H18O2/c1-3-7-15(8-4-1)14-20-17-11-12-19-18(13-17)16-9-5-2-6-10-16/h1-10,13,18H,11-12,14H2/t18-/m0/s1 |
| InChIKey | MDVVJJXHZYBWAZ-SFHVURJKSA-N |
| XLogP | 4.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |