C13H16O2 — CID 10954673
4-(ethoxymethyl)-2-phenyl-2,5-dihydrofuran (PubChem CID 10954673) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-(ethoxymethyl)-2-phenyl-2,5-dihydrofuran.
| Compound Name | 4-(ethoxymethyl)-2-phenyl-2,5-dihydrofuran |
|---|---|
| PubChem CID | 10954673 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 4-(ethoxymethyl)-2-phenyl-2,5-dihydrofuran |
| SMILES | CCOCC1=CC(c2ccccc2)OC1 |
| InChI | InChI=1S/C13H16O2/c1-2-14-9-11-8-13(15-10-11)12-6-4-3-5-7-12/h3-8,13H,2,9-10H2,1H3 |
| InChIKey | KNUSVSXZGFDXBR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|