C12H15NO2 — CID 174059769
4-(ethoxymethylidene)-2-phenyl-1,3-oxazolidine (PubChem CID 174059769) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 4-(ethoxymethylidene)-2-phenyl-1,3-oxazolidine.
| Compound Name | 4-(ethoxymethylidene)-2-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 174059769 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 4-(ethoxymethylidene)-2-phenyl-1,3-oxazolidine |
| SMILES | CCOC=C1COC(c2ccccc2)N1 |
| InChI | InChI=1S/C12H15NO2/c1-2-14-8-11-9-15-12(13-11)10-6-4-3-5-7-10/h3-8,12-13H,2,9H2,1H3 |
| InChIKey | OYKULDDEHAEPLV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|