C29H25NO — CID 11384138
(2R,5S)-1,2,5-triphenyl-3-phenylmethoxy-2,5-dihydropyrrole (PubChem CID 11384138) has the molecular formula C29H25NO and a molecular weight of 403.53 g/mol. Its IUPAC name is (2R,5S)-1,2,5-triphenyl-3-phenylmethoxy-2,5-dihydropyrrole.
| Compound Name | (2R,5S)-1,2,5-triphenyl-3-phenylmethoxy-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 11384138 |
| Molecular Formula | C29H25NO |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (2R,5S)-1,2,5-triphenyl-3-phenylmethoxy-2,5-dihydropyrrole |
| SMILES | C1=C(OCc2ccccc2)[C@@H](c2ccccc2)N(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C29H25NO/c1-5-13-23(14-6-1)22-31-28-21-27(24-15-7-2-8-16-24)30(26-19-11-4-12-20-26)29(28)25-17-9-3-10-18-25/h1-21,27,29H,22H2/t27-,29+/m0/s1 |
| InChIKey | UTQRGTIZSAENDI-LMSSTIIKSA-N |
| XLogP | 7.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |