C11H14N2O — CID 170590289
3-methyl-4-phenylmethoxy-2,3-dihydro-1H-pyrazole (PubChem CID 170590289) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-methyl-4-phenylmethoxy-2,3-dihydro-1H-pyrazole.
| Compound Name | 3-methyl-4-phenylmethoxy-2,3-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 170590289 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 3-methyl-4-phenylmethoxy-2,3-dihydro-1H-pyrazole |
| SMILES | CC1NNC=C1OCc1ccccc1 |
| InChI | InChI=1S/C11H14N2O/c1-9-11(7-12-13-9)14-8-10-5-3-2-4-6-10/h2-7,9,12-13H,8H2,1H3 |
| InChIKey | RVVSMTPRQWUTFC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |