C26H22F2N4O4 — CID 164741438
(2S,11E)-6,7-difluoro-17-hydroxy-2-pyridin-2-ylspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-13,1'-cyclobutane]-15,18-dione (PubChem CID 164741438) has the molecular formula C26H22F2N4O4 and a molecular weight of 492.48 g/mol. Its IUPAC name is (2S,11E)-6,7-difluoro-17-hydroxy-2-pyridin-2-ylspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-13,1'-cyclobutane]-15,18-dione.
| Compound Name | (2S,11E)-6,7-difluoro-17-hydroxy-2-pyridin-2-ylspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-13,1'-cyclobutane]-15,18-dione |
|---|---|
| PubChem CID | 164741438 |
| Molecular Formula | C26H22F2N4O4 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (2S,11E)-6,7-difluoro-17-hydroxy-2-pyridin-2-ylspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-13,1'-cyclobutane]-15,18-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N2CN1C1(/C=C/COc3c(ccc(F)c3F)[C@H]2c2ccccn2)CCC1 |
| InChI | InChI=1S/C26H22F2N4O4/c27-17-7-6-16-21(18-5-1-2-12-29-18)32-15-30(25(35)22-23(34)19(33)8-13-31(22)32)26(9-3-10-26)11-4-14-36-24(16)20(17)28/h1-2,4-8,11-13,21,34H,3,9-10,14-15H2/b11-4+/t21-/m0/s1 |
| InChIKey | RQENDZHHOKMSHS-XOGVDACHSA-N |
| XLogP | 3.24 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|