C27H25F2N3O5 — CID 167283482
(2S,11E,13S)-6,7-difluoro-17-hydroxy-13-(methoxymethyl)-2-(2-methylphenyl)-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione (PubChem CID 167283482) has the molecular formula C27H25F2N3O5 and a molecular weight of 509.51 g/mol. Its IUPAC name is (2S,11E,13S)-6,7-difluoro-17-hydroxy-13-(methoxymethyl)-2-(2-methylphenyl)-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione.
| Compound Name | (2S,11E,13S)-6,7-difluoro-17-hydroxy-13-(methoxymethyl)-2-(2-methylphenyl)-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
|---|---|
| PubChem CID | 167283482 |
| Molecular Formula | C27H25F2N3O5 |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | (2S,11E,13S)-6,7-difluoro-17-hydroxy-13-(methoxymethyl)-2-(2-methylphenyl)-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
| SMILES | COC[C@@H]1/C=C/COc2c(ccc(F)c2F)[C@H](c2ccccc2C)N2CN1C(=O)c1c(O)c(=O)ccn12 |
| InChI | InChI=1S/C27H25F2N3O5/c1-16-6-3-4-8-18(16)23-19-9-10-20(28)22(29)26(19)37-13-5-7-17(14-36-2)30-15-32(23)31-12-11-21(33)25(34)24(31)27(30)35/h3-12,17,23,34H,13-15H2,1-2H3/b7-5+/t17-,23-/m0/s1 |
| InChIKey | WNYJTOSAQFLFMI-UPTLPTDJSA-N |
| XLogP | 3.25 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|