C28H30FN3O4 — CID 165021072
(2S,11E,13R)-7-fluoro-17-hydroxy-2-phenyl-13-propan-2-yl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione;methane (PubChem CID 165021072) has the molecular formula C28H30FN3O4 and a molecular weight of 491.56 g/mol. Its IUPAC name is (2S,11E,13R)-7-fluoro-17-hydroxy-2-phenyl-13-propan-2-yl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione;methane.
| Compound Name | (2S,11E,13R)-7-fluoro-17-hydroxy-2-phenyl-13-propan-2-yl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione;methane |
|---|---|
| PubChem CID | 165021072 |
| Molecular Formula | C28H30FN3O4 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | (2S,11E,13R)-7-fluoro-17-hydroxy-2-phenyl-13-propan-2-yl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione;methane |
| SMILES | C.CC(C)[C@@H]1/C=C/COc2c(F)cccc2[C@H](c2ccccc2)N2CN1C(=O)c1c(O)c(=O)ccn12 |
| InChI | InChI=1S/C27H26FN3O4.CH4/c1-17(2)21-12-7-15-35-26-19(10-6-11-20(26)28)23(18-8-4-3-5-9-18)31-16-29(21)27(34)24-25(33)22(32)13-14-30(24)31;/h3-14,17,21,23,33H,15-16H2,1-2H3;1H4/b12-7+;/t21-,23-;/m0./s1 |
| InChIKey | LEBXWAVJUOXGIB-ZNRXKARHSA-N |
| XLogP | 4.44 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|