C27H25F2N3O4S — CID 165023247
(2S,11E)-6,7-difluoro-17-hydroxy-2-phenylspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-13,1'-cyclobutane]-15,18-dione;sulfane (PubChem CID 165023247) has the molecular formula C27H25F2N3O4S and a molecular weight of 525.58 g/mol. Its IUPAC name is (2S,11E)-6,7-difluoro-17-hydroxy-2-phenylspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-13,1'-cyclobutane]-15,18-dione;sulfane.
| Compound Name | (2S,11E)-6,7-difluoro-17-hydroxy-2-phenylspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-13,1'-cyclobutane]-15,18-dione;sulfane |
|---|---|
| PubChem CID | 165023247 |
| Molecular Formula | C27H25F2N3O4S |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | (2S,11E)-6,7-difluoro-17-hydroxy-2-phenylspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-13,1'-cyclobutane]-15,18-dione;sulfane |
| SMILES | O=C1c2c(O)c(=O)ccn2N2CN1C1(/C=C/COc3c(ccc(F)c3F)[C@@H]2c2ccccc2)CCC1.S |
| InChI | InChI=1S/C27H23F2N3O4.H2S/c28-19-9-8-18-22(17-6-2-1-3-7-17)32-16-30(26(35)23-24(34)20(33)10-14-31(23)32)27(11-4-12-27)13-5-15-36-25(18)21(19)29;/h1-3,5-10,13-14,22,34H,4,11-12,15-16H2;1H2/b13-5+;/t22-;/m0./s1 |
| InChIKey | LMJJGBPIZLLMIO-OAWHSVJSSA-N |
| XLogP | 3.96 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|