C22H17F2N3O4S — CID 166764905
(2S,11Z)-6,7-difluoro-17-hydroxy-2-thiophen-2-yl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione (PubChem CID 166764905) has the molecular formula C22H17F2N3O4S and a molecular weight of 457.46 g/mol. Its IUPAC name is (2S,11Z)-6,7-difluoro-17-hydroxy-2-thiophen-2-yl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione.
| Compound Name | (2S,11Z)-6,7-difluoro-17-hydroxy-2-thiophen-2-yl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
|---|---|
| PubChem CID | 166764905 |
| Molecular Formula | C22H17F2N3O4S |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | (2S,11Z)-6,7-difluoro-17-hydroxy-2-thiophen-2-yl-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N2CN1C/C=C\COc1c(ccc(F)c1F)[C@H]2c1cccs1 |
| InChI | InChI=1S/C22H17F2N3O4S/c23-14-6-5-13-18(16-4-3-11-32-16)27-12-25(8-1-2-10-31-21(13)17(14)24)22(30)19-20(29)15(28)7-9-26(19)27/h1-7,9,11,18,29H,8,10,12H2/b2-1-/t18-/m0/s1 |
| InChIKey | RUBJBVHXWIDTBN-LPQSXRFUSA-N |
| XLogP | 2.98 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|