C25H23F2N3O4S — CID 166888617
(11E)-6,7-difluoro-19-hydroxy-2-(2-methylthiophen-3-yl)-9-oxa-1,16,23-triazatetracyclo[14.7.1.03,8.018,23]tetracosa-3(8),4,6,11,18,21-hexaene-17,20-dione (PubChem CID 166888617) has the molecular formula C25H23F2N3O4S and a molecular weight of 499.54 g/mol. Its IUPAC name is (11E)-6,7-difluoro-19-hydroxy-2-(2-methylthiophen-3-yl)-9-oxa-1,16,23-triazatetracyclo[14.7.1.03,8.018,23]tetracosa-3(8),4,6,11,18,21-hexaene-17,20-dione.
| Compound Name | (11E)-6,7-difluoro-19-hydroxy-2-(2-methylthiophen-3-yl)-9-oxa-1,16,23-triazatetracyclo[14.7.1.03,8.018,23]tetracosa-3(8),4,6,11,18,21-hexaene-17,20-dione |
|---|---|
| PubChem CID | 166888617 |
| Molecular Formula | C25H23F2N3O4S |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | (11E)-6,7-difluoro-19-hydroxy-2-(2-methylthiophen-3-yl)-9-oxa-1,16,23-triazatetracyclo[14.7.1.03,8.018,23]tetracosa-3(8),4,6,11,18,21-hexaene-17,20-dione |
| SMILES | Cc1sccc1C1c2ccc(F)c(F)c2OC/C=C/CCCN2CN1n1ccc(=O)c(O)c1C2=O |
| InChI | InChI=1S/C25H23F2N3O4S/c1-15-16(9-13-35-15)21-17-6-7-18(26)20(27)24(17)34-12-5-3-2-4-10-28-14-30(21)29-11-8-19(31)23(32)22(29)25(28)33/h3,5-9,11,13,21,32H,2,4,10,12,14H2,1H3/b5-3+ |
| InChIKey | MSDSBOREOSIOLH-HWKANZROSA-N |
| XLogP | 4.07 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|