C27H25F2N3O4 — CID 163576406
(2R,11E,13S)-13-ethyl-6,7-difluoro-17-hydroxy-2-(2-methylphenyl)-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione (PubChem CID 163576406) has the molecular formula C27H25F2N3O4 and a molecular weight of 493.51 g/mol. Its IUPAC name is (2R,11E,13S)-13-ethyl-6,7-difluoro-17-hydroxy-2-(2-methylphenyl)-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione.
| Compound Name | (2R,11E,13S)-13-ethyl-6,7-difluoro-17-hydroxy-2-(2-methylphenyl)-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
|---|---|
| PubChem CID | 163576406 |
| Molecular Formula | C27H25F2N3O4 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (2R,11E,13S)-13-ethyl-6,7-difluoro-17-hydroxy-2-(2-methylphenyl)-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
| SMILES | CC[C@H]1/C=C/COc2c(ccc(F)c2F)[C@@H](c2ccccc2C)N2CN1C(=O)c1c(O)c(=O)ccn12 |
| InChI | InChI=1S/C27H25F2N3O4/c1-3-17-8-6-14-36-26-19(10-11-20(28)22(26)29)23(18-9-5-4-7-16(18)2)32-15-30(17)27(35)24-25(34)21(33)12-13-31(24)32/h4-13,17,23,34H,3,14-15H2,1-2H3/b8-6+/t17-,23+/m0/s1 |
| InChIKey | GDVMWTJVEWLGRL-UUHZOMLHSA-N |
| XLogP | 4.01 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|