C23H19F2N3O4S — CID 166764911
(2S,11Z)-6,7-difluoro-17-hydroxy-2-(4-methylthiophen-2-yl)-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione (PubChem CID 166764911) has the molecular formula C23H19F2N3O4S and a molecular weight of 471.49 g/mol. Its IUPAC name is (2S,11Z)-6,7-difluoro-17-hydroxy-2-(4-methylthiophen-2-yl)-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione.
| Compound Name | (2S,11Z)-6,7-difluoro-17-hydroxy-2-(4-methylthiophen-2-yl)-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
|---|---|
| PubChem CID | 166764911 |
| Molecular Formula | C23H19F2N3O4S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (2S,11Z)-6,7-difluoro-17-hydroxy-2-(4-methylthiophen-2-yl)-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
| SMILES | Cc1csc([C@@H]2c3ccc(F)c(F)c3OC/C=C\CN3CN2n2ccc(=O)c(O)c2C3=O)c1 |
| InChI | InChI=1S/C23H19F2N3O4S/c1-13-10-17(33-11-13)19-14-4-5-15(24)18(25)22(14)32-9-3-2-7-26-12-28(19)27-8-6-16(29)21(30)20(27)23(26)31/h2-6,8,10-11,19,30H,7,9,12H2,1H3/b3-2-/t19-/m0/s1 |
| InChIKey | PUPVNPHLNXTWDA-AXMVSILFSA-N |
| XLogP | 3.29 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|