C26H25F2N3O5S — CID 166888320
(11E)-6,7-difluoro-19-hydroxy-14-methoxy-2-(2-methylthiophen-3-yl)-9-oxa-1,16,23-triazatetracyclo[14.7.1.03,8.018,23]tetracosa-3(8),4,6,11,18,21-hexaene-17,20-dione (PubChem CID 166888320) has the molecular formula C26H25F2N3O5S and a molecular weight of 529.57 g/mol. Its IUPAC name is (11E)-6,7-difluoro-19-hydroxy-14-methoxy-2-(2-methylthiophen-3-yl)-9-oxa-1,16,23-triazatetracyclo[14.7.1.03,8.018,23]tetracosa-3(8),4,6,11,18,21-hexaene-17,20-dione.
| Compound Name | (11E)-6,7-difluoro-19-hydroxy-14-methoxy-2-(2-methylthiophen-3-yl)-9-oxa-1,16,23-triazatetracyclo[14.7.1.03,8.018,23]tetracosa-3(8),4,6,11,18,21-hexaene-17,20-dione |
|---|---|
| PubChem CID | 166888320 |
| Molecular Formula | C26H25F2N3O5S |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | (11E)-6,7-difluoro-19-hydroxy-14-methoxy-2-(2-methylthiophen-3-yl)-9-oxa-1,16,23-triazatetracyclo[14.7.1.03,8.018,23]tetracosa-3(8),4,6,11,18,21-hexaene-17,20-dione |
| SMILES | COC1C/C=C/COc2c(ccc(F)c2F)C(c2ccsc2C)N2CN(C1)C(=O)c1c(O)c(=O)ccn12 |
| InChI | InChI=1S/C26H25F2N3O5S/c1-15-17(9-12-37-15)22-18-6-7-19(27)21(28)25(18)36-11-4-3-5-16(35-2)13-29-14-31(22)30-10-8-20(32)24(33)23(30)26(29)34/h3-4,6-10,12,16,22,33H,5,11,13-14H2,1-2H3/b4-3+ |
| InChIKey | JTXIQCDNPPRXPD-ONEGZZNKSA-N |
| XLogP | 3.70 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|