C25H20ClF2N3O4S — CID 166888211
(11E)-2-(3-chlorothiophen-2-yl)-5,6-difluoro-17-hydroxyspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3,5,7,11,16,19-hexaene-13,1'-cyclobutane]-15,18-dione (PubChem CID 166888211) has the molecular formula C25H20ClF2N3O4S and a molecular weight of 531.97 g/mol. Its IUPAC name is (11E)-2-(3-chlorothiophen-2-yl)-5,6-difluoro-17-hydroxyspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3,5,7,11,16,19-hexaene-13,1'-cyclobutane]-15,18-dione.
| Compound Name | (11E)-2-(3-chlorothiophen-2-yl)-5,6-difluoro-17-hydroxyspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3,5,7,11,16,19-hexaene-13,1'-cyclobutane]-15,18-dione |
|---|---|
| PubChem CID | 166888211 |
| Molecular Formula | C25H20ClF2N3O4S |
| Molecular Weight | 531.97 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | (11E)-2-(3-chlorothiophen-2-yl)-5,6-difluoro-17-hydroxyspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3,5,7,11,16,19-hexaene-13,1'-cyclobutane]-15,18-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N2CN1C1(/C=C/COc3cc(F)c(F)cc3C2c2sccc2Cl)CCC1 |
| InChI | InChI=1S/C25H20ClF2N3O4S/c26-15-4-10-36-23(15)20-14-11-16(27)17(28)12-19(14)35-9-2-7-25(5-1-6-25)29-13-31(20)30-8-3-18(32)22(33)21(30)24(29)34/h2-4,7-8,10-12,20,33H,1,5-6,9,13H2/b7-2+ |
| InChIKey | QZBCGMSAMWYRMK-FARCUNLSSA-N |
| XLogP | 4.56 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.97 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|