C28H27N3O4S — CID 165026581
(1R,12E)-7-hydroxyspiro[15-oxa-22-thia-2,3,10-triazahexacyclo[14.12.1.12,10.03,8.020,29.023,28]triaconta-4,7,12,16,18,20(29),23,25,27-nonaene-11,1'-cyclopropane]-6,9-dione;methane (PubChem CID 165026581) has the molecular formula C28H27N3O4S and a molecular weight of 501.61 g/mol. Its IUPAC name is (1R,12E)-7-hydroxyspiro[15-oxa-22-thia-2,3,10-triazahexacyclo[14.12.1.12,10.03,8.020,29.023,28]triaconta-4,7,12,16,18,20(29),23,25,27-nonaene-11,1'-cyclopropane]-6,9-dione;methane.
| Compound Name | (1R,12E)-7-hydroxyspiro[15-oxa-22-thia-2,3,10-triazahexacyclo[14.12.1.12,10.03,8.020,29.023,28]triaconta-4,7,12,16,18,20(29),23,25,27-nonaene-11,1'-cyclopropane]-6,9-dione;methane |
|---|---|
| PubChem CID | 165026581 |
| Molecular Formula | C28H27N3O4S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | (1R,12E)-7-hydroxyspiro[15-oxa-22-thia-2,3,10-triazahexacyclo[14.12.1.12,10.03,8.020,29.023,28]triaconta-4,7,12,16,18,20(29),23,25,27-nonaene-11,1'-cyclopropane]-6,9-dione;methane |
| SMILES | C.O=C1c2c(O)c(=O)ccn2N2CN1C1(/C=C\COc3cccc4c3[C@@H]2c2ccccc2SC4)CC1 |
| InChI | InChI=1S/C27H23N3O4S.CH4/c31-19-9-13-29-24(25(19)32)26(33)28-16-30(29)23-18-6-1-2-8-21(18)35-15-17-5-3-7-20(22(17)23)34-14-4-10-27(28)11-12-27;/h1-10,13,23,32H,11-12,14-16H2;1H4/b10-4-;/t23-;/m0./s1 |
| InChIKey | LZDOUQJCSDVHGD-AJSZKTPMSA-N |
| XLogP | 4.42 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|