C26H21F2N3O4S — CID 167027996
(1R,12E)-11-(difluoromethyl)-7-hydroxy-15-oxa-22-thia-2,3,10-triazahexacyclo[14.12.1.12,10.03,8.020,29.023,28]triaconta-4,7,12,16,18,20(29),23,25,27-nonaene-6,9-dione (PubChem CID 167027996) has the molecular formula C26H21F2N3O4S and a molecular weight of 509.53 g/mol. Its IUPAC name is (1R,12E)-11-(difluoromethyl)-7-hydroxy-15-oxa-22-thia-2,3,10-triazahexacyclo[14.12.1.12,10.03,8.020,29.023,28]triaconta-4,7,12,16,18,20(29),23,25,27-nonaene-6,9-dione.
| Compound Name | (1R,12E)-11-(difluoromethyl)-7-hydroxy-15-oxa-22-thia-2,3,10-triazahexacyclo[14.12.1.12,10.03,8.020,29.023,28]triaconta-4,7,12,16,18,20(29),23,25,27-nonaene-6,9-dione |
|---|---|
| PubChem CID | 167027996 |
| Molecular Formula | C26H21F2N3O4S |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | (1R,12E)-11-(difluoromethyl)-7-hydroxy-15-oxa-22-thia-2,3,10-triazahexacyclo[14.12.1.12,10.03,8.020,29.023,28]triaconta-4,7,12,16,18,20(29),23,25,27-nonaene-6,9-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N2CN1C(C(F)F)/C=C\COc1cccc3c1[C@@H]2c1ccccc1SC3 |
| InChI | InChI=1S/C26H21F2N3O4S/c27-25(28)17-7-4-12-35-19-8-3-5-15-13-36-20-9-2-1-6-16(20)22(21(15)19)31-14-29(17)26(34)23-24(33)18(32)10-11-30(23)31/h1-11,17,22,25,33H,12-14H2/b7-4-/t17?,22-/m0/s1 |
| InChIKey | GWVBHJHJCJICDK-MNSYQXPHSA-N |
| XLogP | 3.88 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|