C27H29N3O2S — CID 134484052
1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-3-(2,2-dimethylpropyl)-5-methyl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 134484052) has the molecular formula C27H29N3O2S and a molecular weight of 459.62 g/mol. Its IUPAC name is 1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-3-(2,2-dimethylpropyl)-5-methyl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-3-(2,2-dimethylpropyl)-5-methyl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 134484052 |
| Molecular Formula | C27H29N3O2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-3-(2,2-dimethylpropyl)-5-methyl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | Cc1c2n(ccc1=O)N(C1c3ccccc3CSc3ccccc31)CN(CC(C)(C)C)C2=O |
| InChI | InChI=1S/C27H29N3O2S/c1-18-22(31)13-14-29-24(18)26(32)28(16-27(2,3)4)17-30(29)25-20-10-6-5-9-19(20)15-33-23-12-8-7-11-21(23)25/h5-14,25H,15-17H2,1-4H3 |
| InChIKey | ZIBJFFNAZSYHDL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |