C29H33N3O2S — CID 70820363
1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-methyl-3-[(3S)-5-methylhexan-3-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 70820363) has the molecular formula C29H33N3O2S and a molecular weight of 487.67 g/mol. Its IUPAC name is 1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-methyl-3-[(3S)-5-methylhexan-3-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-methyl-3-[(3S)-5-methylhexan-3-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 70820363 |
| Molecular Formula | C29H33N3O2S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-methyl-3-[(3S)-5-methylhexan-3-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CC[C@@H](CC(C)C)N1CN(C2c3ccccc3CSc3ccccc32)n2ccc(=O)c(C)c2C1=O |
| InChI | InChI=1S/C29H33N3O2S/c1-5-22(16-19(2)3)30-18-32(31-15-14-25(33)20(4)27(31)29(30)34)28-23-11-7-6-10-21(23)17-35-26-13-9-8-12-24(26)28/h6-15,19,22,28H,5,16-18H2,1-4H3/t22-,28?/m0/s1 |
| InChIKey | QOYZSYYSXJPEGJ-XYXHBKGXSA-N |
| XLogP | 5.73 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |