C28H28F3N3O4S — CID 130410761
1-[(11S)-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-(1-hydroxy-2-methylpropoxy)-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 130410761) has the molecular formula C28H28F3N3O4S and a molecular weight of 559.61 g/mol. Its IUPAC name is 1-[(11S)-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-(1-hydroxy-2-methylpropoxy)-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-[(11S)-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-(1-hydroxy-2-methylpropoxy)-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 130410761 |
| Molecular Formula | C28H28F3N3O4S |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 1-[(11S)-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-(1-hydroxy-2-methylpropoxy)-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CC(C)C(O)Oc1c2n(ccc1=O)N([C@H]1c3ccccc3CSc3ccccc31)CN([C@H](C)C(F)(F)F)C2=O |
| InChI | InChI=1S/C28H28F3N3O4S/c1-16(2)27(37)38-25-21(35)12-13-33-24(25)26(36)32(17(3)28(29,30)31)15-34(33)23-19-9-5-4-8-18(19)14-39-22-11-7-6-10-20(22)23/h4-13,16-17,23,27,37H,14-15H2,1-3H3/t17-,23+,27?/m1/s1 |
| InChIKey | RTNWLOLEJDHDLM-VJUUSILPSA-N |
| XLogP | 4.90 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|