C25H22F3N3O3S — CID 67471862
5-hydroxy-1-[(6S,11R)-6-methyl-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 67471862) has the molecular formula C25H22F3N3O3S and a molecular weight of 501.53 g/mol. Its IUPAC name is 5-hydroxy-1-[(6S,11R)-6-methyl-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 5-hydroxy-1-[(6S,11R)-6-methyl-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 67471862 |
| Molecular Formula | C25H22F3N3O3S |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 5-hydroxy-1-[(6S,11R)-6-methyl-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | C[C@@H]1Sc2ccccc2[C@H](N2CN([C@H](C)C(F)(F)F)C(=O)c3c(O)c(=O)ccn32)c2ccccc21 |
| InChI | InChI=1S/C25H22F3N3O3S/c1-14-16-7-3-4-8-17(16)21(18-9-5-6-10-20(18)35-14)31-13-29(15(2)25(26,27)28)24(34)22-23(33)19(32)11-12-30(22)31/h3-12,14-15,21,33H,13H2,1-2H3/t14-,15+,21+/m0/s1 |
| InChIKey | GTDCLLNSBIEVET-PDSXEYIOSA-N |
| XLogP | 4.81 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |