C29H25F3N2O3S — CID 130410662
9-hydroxy-4-[(11S)-6-methyl-10-prop-1-ynyl-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-2-[(2R)-1,1,1-trifluoropropan-2-yl]-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione (PubChem CID 130410662) has the molecular formula C29H25F3N2O3S and a molecular weight of 538.59 g/mol. Its IUPAC name is 9-hydroxy-4-[(11S)-6-methyl-10-prop-1-ynyl-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-2-[(2R)-1,1,1-trifluoropropan-2-yl]-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione.
| Compound Name | 9-hydroxy-4-[(11S)-6-methyl-10-prop-1-ynyl-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-2-[(2R)-1,1,1-trifluoropropan-2-yl]-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
|---|---|
| PubChem CID | 130410662 |
| Molecular Formula | C29H25F3N2O3S |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 9-hydroxy-4-[(11S)-6-methyl-10-prop-1-ynyl-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-2-[(2R)-1,1,1-trifluoropropan-2-yl]-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
| SMILES | CC#Cc1cccc2c1[C@H](C1CN([C@H](C)C(F)(F)F)C(=O)c3c(O)c(=O)ccn31)c1ccccc1SC2C |
| InChI | InChI=1S/C29H25F3N2O3S/c1-4-8-18-9-7-11-19-16(2)38-23-12-6-5-10-20(23)25(24(18)19)21-15-34(17(3)29(30,31)32)28(37)26-27(36)22(35)13-14-33(21)26/h5-7,9-14,16-17,21,25,36H,15H2,1-3H3/t16?,17-,21?,25+/m1/s1 |
| InChIKey | AVJJZKSCUYEWFZ-MVDGMMRSSA-N |
| XLogP | 5.87 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|