C25H21N3O3 — CID 87412000
2-[9-hydroxy-1,8-dioxo-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3,4-dihydropyrido[1,2-a]pyrazin-2-yl]acetonitrile (PubChem CID 87412000) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[9-hydroxy-1,8-dioxo-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3,4-dihydropyrido[1,2-a]pyrazin-2-yl]acetonitrile.
| Compound Name | 2-[9-hydroxy-1,8-dioxo-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3,4-dihydropyrido[1,2-a]pyrazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 87412000 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-[9-hydroxy-1,8-dioxo-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3,4-dihydropyrido[1,2-a]pyrazin-2-yl]acetonitrile |
| SMILES | N#CCN1CC(C2c3ccccc3CCc3ccccc32)n2ccc(=O)c(O)c2C1=O |
| InChI | InChI=1S/C25H21N3O3/c26-12-14-27-15-20(28-13-11-21(29)24(30)23(28)25(27)31)22-18-7-3-1-5-16(18)9-10-17-6-2-4-8-19(17)22/h1-8,11,13,20,22,30H,9-10,14-15H2 |
| InChIKey | GSPQCUDBVDCHJC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|