C28H23F3N2O4S — CID 130410755
4-[(13S)-7,13-dihydro-2H-[1]benzothiepino[3,4-h]chromen-13-yl]-9-hydroxy-2-[(2R)-1,1,1-trifluoropropan-2-yl]-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione (PubChem CID 130410755) has the molecular formula C28H23F3N2O4S and a molecular weight of 540.56 g/mol. Its IUPAC name is 4-[(13S)-7,13-dihydro-2H-[1]benzothiepino[3,4-h]chromen-13-yl]-9-hydroxy-2-[(2R)-1,1,1-trifluoropropan-2-yl]-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione.
| Compound Name | 4-[(13S)-7,13-dihydro-2H-[1]benzothiepino[3,4-h]chromen-13-yl]-9-hydroxy-2-[(2R)-1,1,1-trifluoropropan-2-yl]-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
|---|---|
| PubChem CID | 130410755 |
| Molecular Formula | C28H23F3N2O4S |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 4-[(13S)-7,13-dihydro-2H-[1]benzothiepino[3,4-h]chromen-13-yl]-9-hydroxy-2-[(2R)-1,1,1-trifluoropropan-2-yl]-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
| SMILES | C[C@@H](N1CC([C@@H]2c3ccccc3SCc3ccc4c(c32)OCC=C4)n2ccc(=O)c(O)c2C1=O)C(F)(F)F |
| InChI | InChI=1S/C28H23F3N2O4S/c1-15(28(29,30)31)33-13-19(32-11-10-20(34)25(35)24(32)27(33)36)23-18-6-2-3-7-21(18)38-14-17-9-8-16-5-4-12-37-26(16)22(17)23/h2-11,15,19,23,35H,12-14H2,1H3/t15-,19?,23+/m1/s1 |
| InChIKey | MZGQICPPCHFOCJ-IYMOSDBZSA-N |
| XLogP | 5.34 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |