C24H18ClF4N3O3S — CID 134484096
1-(3-chloro-7-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 134484096) has the molecular formula C24H18ClF4N3O3S and a molecular weight of 539.94 g/mol. Its IUPAC name is 1-(3-chloro-7-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-(3-chloro-7-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 134484096 |
| Molecular Formula | C24H18ClF4N3O3S |
| Molecular Weight | 539.94 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 1-(3-chloro-7-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | C[C@@H](N1CN(C2c3ccc(Cl)cc3SCc3c(F)cccc32)n2ccc(=O)c(O)c2C1=O)C(F)(F)F |
| InChI | InChI=1S/C24H18ClF4N3O3S/c1-12(24(27,28)29)30-11-32(31-8-7-18(33)22(34)21(31)23(30)35)20-14-3-2-4-17(26)16(14)10-36-19-9-13(25)5-6-15(19)20/h2-9,12,20,34H,10-11H2,1H3/t12-,20?/m1/s1 |
| InChIKey | LBCOSEDXUSLXTC-ZRIYNBNISA-N |
| XLogP | 5.04 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.94 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |