C26H24F3N3O5S — CID 155248094
1-(3,8-dimethoxy-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 155248094) has the molecular formula C26H24F3N3O5S and a molecular weight of 547.56 g/mol. Its IUPAC name is 1-(3,8-dimethoxy-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-(3,8-dimethoxy-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 155248094 |
| Molecular Formula | C26H24F3N3O5S |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 1-(3,8-dimethoxy-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-5-hydroxy-3-[(2R)-1,1,1-trifluoropropan-2-yl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | COc1ccc2c(c1)CSc1cc(OC)ccc1C2N1CN([C@H](C)C(F)(F)F)C(=O)c2c(O)c(=O)ccn21 |
| InChI | InChI=1S/C26H24F3N3O5S/c1-14(26(27,28)29)30-13-32(31-9-8-20(33)24(34)23(31)25(30)35)22-18-6-4-16(36-2)10-15(18)12-38-21-11-17(37-3)5-7-19(21)22/h4-11,14,22,34H,12-13H2,1-3H3/t14-,22?/m1/s1 |
| InChIKey | NAVDRHPXGWPWJS-HNNQXCQYSA-N |
| XLogP | 4.27 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |