C15H28O4 — CID 155067802
(3,5-diethyl-4,4-dihydroxy-5-methylheptan-3-yl) prop-2-enoate (PubChem CID 155067802) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is (3,5-diethyl-4,4-dihydroxy-5-methylheptan-3-yl) prop-2-enoate.
| Compound Name | (3,5-diethyl-4,4-dihydroxy-5-methylheptan-3-yl) prop-2-enoate |
|---|---|
| PubChem CID | 155067802 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (3,5-diethyl-4,4-dihydroxy-5-methylheptan-3-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC(CC)(CC)C(O)(O)C(C)(CC)CC |
| InChI | InChI=1S/C15H28O4/c1-7-12(16)19-14(10-4,11-5)15(17,18)13(6,8-2)9-3/h7,17-18H,1,8-11H2,2-6H3 |
| InChIKey | RBRNOTXHRLDOMI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|