C35H42ClF5N4O5 — CID 155068384
tert-butyl N-[1-[2-chloro-4-[4-[1-(3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl)piperidin-4-yl]piperidin-1-yl]benzoyl]azetidin-3-yl]carbamate (PubChem CID 155068384) has the molecular formula C35H42ClF5N4O5 and a molecular weight of 729.19 g/mol. Its IUPAC name is tert-butyl N-[1-[2-chloro-4-[4-[1-(3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl)piperidin-4-yl]piperidin-1-yl]benzoyl]azetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-chloro-4-[4-[1-(3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl)piperidin-4-yl]piperidin-1-yl]benzoyl]azetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 155068384 |
| Molecular Formula | C35H42ClF5N4O5 |
| Molecular Weight | 729.19 g/mol |
| Exact Mass | 728.28 |
| IUPAC Name | tert-butyl N-[1-[2-chloro-4-[4-[1-(3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl)piperidin-4-yl]piperidin-1-yl]benzoyl]azetidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(C(=O)c2ccc(N3CCC(C4CCN(C(=O)C(O)(c5ccccc5)C(F)(F)C(F)(F)F)CC4)CC3)cc2Cl)C1 |
| InChI | InChI=1S/C35H42ClF5N4O5/c1-32(2,3)50-31(48)42-25-20-45(21-25)29(46)27-10-9-26(19-28(27)36)43-15-11-22(12-16-43)23-13-17-44(18-14-23)30(47)33(49,24-7-5-4-6-8-24)34(37,38)35(39,40)41/h4-10,19,22-23,25,49H,11-18,20-21H2,1-3H3,(H,42,48) |
| InChIKey | IOPKVKRGXXFVLS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.19 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|