C30H35ClF5N3O3 — CID 137355297
2-chloro-N,N-dimethyl-4-[4-[[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl]piperidin-4-yl]methyl]piperidin-1-yl]benzamide (PubChem CID 137355297) has the molecular formula C30H35ClF5N3O3 and a molecular weight of 616.07 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-4-[4-[[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl]piperidin-4-yl]methyl]piperidin-1-yl]benzamide.
| Compound Name | 2-chloro-N,N-dimethyl-4-[4-[[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl]piperidin-4-yl]methyl]piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 137355297 |
| Molecular Formula | C30H35ClF5N3O3 |
| Molecular Weight | 616.07 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | 2-chloro-N,N-dimethyl-4-[4-[[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl]piperidin-4-yl]methyl]piperidin-1-yl]benzamide |
| SMILES | CN(C)C(=O)c1ccc(N2CCC(CC3CCN(C(=O)[C@](O)(c4ccccc4)C(F)(F)C(F)(F)F)CC3)CC2)cc1Cl |
| InChI | InChI=1S/C30H35ClF5N3O3/c1-37(2)26(40)24-9-8-23(19-25(24)31)38-14-10-20(11-15-38)18-21-12-16-39(17-13-21)27(41)28(42,22-6-4-3-5-7-22)29(32,33)30(34,35)36/h3-9,19-21,42H,10-18H2,1-2H3/t28-/m1/s1 |
| InChIKey | FYPZSSFLDJATIS-MUUNZHRXSA-N |
| XLogP | 5.97 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.07 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|