C29H33ClF5N3O3 — CID 135360512
2-chloro-N,N-dimethyl-4-[4-[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl]piperidin-4-yl]piperidin-1-yl]benzamide (PubChem CID 135360512) has the molecular formula C29H33ClF5N3O3 and a molecular weight of 602.04 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-4-[4-[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl]piperidin-4-yl]piperidin-1-yl]benzamide.
| Compound Name | 2-chloro-N,N-dimethyl-4-[4-[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl]piperidin-4-yl]piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 135360512 |
| Molecular Formula | C29H33ClF5N3O3 |
| Molecular Weight | 602.04 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | 2-chloro-N,N-dimethyl-4-[4-[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl]piperidin-4-yl]piperidin-1-yl]benzamide |
| SMILES | CN(C)C(=O)c1ccc(N2CCC(C3CCN(C(=O)[C@](O)(c4ccccc4)C(F)(F)C(F)(F)F)CC3)CC2)cc1Cl |
| InChI | InChI=1S/C29H33ClF5N3O3/c1-36(2)25(39)23-9-8-22(18-24(23)30)37-14-10-19(11-15-37)20-12-16-38(17-13-20)26(40)27(41,21-6-4-3-5-7-21)28(31,32)29(33,34)35/h3-9,18-20,41H,10-17H2,1-2H3/t27-/m1/s1 |
| InChIKey | OUSKTCVCXQISMR-HHHXNRCGSA-N |
| XLogP | 5.58 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.04 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|