C27H32ClF3N2O3 — CID 157130819
2-chloro-N,N-dimethyl-4-[4-(7,7,7-trifluoro-6-hydroxy-5-oxo-6-phenylheptyl)piperidin-1-yl]benzamide (PubChem CID 157130819) has the molecular formula C27H32ClF3N2O3 and a molecular weight of 525.01 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-4-[4-(7,7,7-trifluoro-6-hydroxy-5-oxo-6-phenylheptyl)piperidin-1-yl]benzamide.
| Compound Name | 2-chloro-N,N-dimethyl-4-[4-(7,7,7-trifluoro-6-hydroxy-5-oxo-6-phenylheptyl)piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 157130819 |
| Molecular Formula | C27H32ClF3N2O3 |
| Molecular Weight | 525.01 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 2-chloro-N,N-dimethyl-4-[4-(7,7,7-trifluoro-6-hydroxy-5-oxo-6-phenylheptyl)piperidin-1-yl]benzamide |
| SMILES | CN(C)C(=O)c1ccc(N2CCC(CCCCC(=O)C(O)(c3ccccc3)C(F)(F)F)CC2)cc1Cl |
| InChI | InChI=1S/C27H32ClF3N2O3/c1-32(2)25(35)22-13-12-21(18-23(22)28)33-16-14-19(15-17-33)8-6-7-11-24(34)26(36,27(29,30)31)20-9-4-3-5-10-20/h3-5,9-10,12-13,18-19,36H,6-8,11,14-17H2,1-2H3 |
| InChIKey | JRLQGZNPJSURBF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.01 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|