C28H33F2N3O3 — CID 155070033
cyclobutyl-[(2S)-3-[(2,5-difluorophenyl)methyl]-2-(hydroxymethyl)-14-methoxy-3,7,17-triazatricyclo[8.7.0.011,16]heptadeca-1(10),11(16),12,14-tetraen-7-yl]methanone (PubChem CID 155070033) has the molecular formula C28H33F2N3O3 and a molecular weight of 497.59 g/mol. Its IUPAC name is cyclobutyl-[(2S)-3-[(2,5-difluorophenyl)methyl]-2-(hydroxymethyl)-14-methoxy-3,7,17-triazatricyclo[8.7.0.011,16]heptadeca-1(10),11(16),12,14-tetraen-7-yl]methanone.
| Compound Name | cyclobutyl-[(2S)-3-[(2,5-difluorophenyl)methyl]-2-(hydroxymethyl)-14-methoxy-3,7,17-triazatricyclo[8.7.0.011,16]heptadeca-1(10),11(16),12,14-tetraen-7-yl]methanone |
|---|---|
| PubChem CID | 155070033 |
| Molecular Formula | C28H33F2N3O3 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | cyclobutyl-[(2S)-3-[(2,5-difluorophenyl)methyl]-2-(hydroxymethyl)-14-methoxy-3,7,17-triazatricyclo[8.7.0.011,16]heptadeca-1(10),11(16),12,14-tetraen-7-yl]methanone |
| SMILES | COc1ccc2c3c([nH]c2c1)[C@@H](CO)N(Cc1cc(F)ccc1F)CCCN(C(=O)C1CCC1)CC3 |
| InChI | InChI=1S/C28H33F2N3O3/c1-36-21-7-8-22-23-10-13-32(28(35)18-4-2-5-18)11-3-12-33(16-19-14-20(29)6-9-24(19)30)26(17-34)27(23)31-25(22)15-21/h6-9,14-15,18,26,31,34H,2-5,10-13,16-17H2,1H3/t26-/m1/s1 |
| InChIKey | XYQZSPGOKKZCDK-AREMUKBSSA-N |
| XLogP | 4.57 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|