C17H29NO3Si — CID 15507039
tert-butyl (3R,5S)-5-ethenyl-2-oxo-3-[(E)-3-trimethylsilylprop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 15507039) has the molecular formula C17H29NO3Si and a molecular weight of 323.51 g/mol. Its IUPAC name is tert-butyl (3R,5S)-5-ethenyl-2-oxo-3-[(E)-3-trimethylsilylprop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,5S)-5-ethenyl-2-oxo-3-[(E)-3-trimethylsilylprop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15507039 |
| Molecular Formula | C17H29NO3Si |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | tert-butyl (3R,5S)-5-ethenyl-2-oxo-3-[(E)-3-trimethylsilylprop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@H](/C=C/C[Si](C)(C)C)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO3Si/c1-8-14-12-13(10-9-11-22(5,6)7)15(19)18(14)16(20)21-17(2,3)4/h8-10,13-14H,1,11-12H2,2-7H3/b10-9+/t13-,14+/m0/s1 |
| InChIKey | XKLPGUPOECGKAD-XACNLCELSA-N |
| XLogP | 4.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|