C11H14FNO3 — CID 130941719
tert-butyl (1R,4R,7R)-7-fluoro-3-oxo-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 130941719) has the molecular formula C11H14FNO3 and a molecular weight of 227.23 g/mol. Its IUPAC name is tert-butyl (1R,4R,7R)-7-fluoro-3-oxo-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | tert-butyl (1R,4R,7R)-7-fluoro-3-oxo-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 130941719 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | tert-butyl (1R,4R,7R)-7-fluoro-3-oxo-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@H]2C=C[C@@H]1[C@@H]2F |
| InChI | InChI=1S/C11H14FNO3/c1-11(2,3)16-10(15)13-7-5-4-6(8(7)12)9(13)14/h4-8H,1-3H3/t6-,7+,8+/m0/s1 |
| InChIKey | NPGXIVFRXAIPMW-XLPZGREQSA-N |
| XLogP | 1.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|