C18H17N3O3S — CID 155073649
5-methoxy-N-(2-methoxyprop-2-enyl)-2-thiophen-2-yl-1,7-naphthyridine-6-carboxamide (PubChem CID 155073649) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 5-methoxy-N-(2-methoxyprop-2-enyl)-2-thiophen-2-yl-1,7-naphthyridine-6-carboxamide.
| Compound Name | 5-methoxy-N-(2-methoxyprop-2-enyl)-2-thiophen-2-yl-1,7-naphthyridine-6-carboxamide |
|---|---|
| PubChem CID | 155073649 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 5-methoxy-N-(2-methoxyprop-2-enyl)-2-thiophen-2-yl-1,7-naphthyridine-6-carboxamide |
| SMILES | C=C(CNC(=O)c1ncc2nc(-c3cccs3)ccc2c1OC)OC |
| InChI | InChI=1S/C18H17N3O3S/c1-11(23-2)9-20-18(22)16-17(24-3)12-6-7-13(15-5-4-8-25-15)21-14(12)10-19-16/h4-8,10H,1,9H2,2-3H3,(H,20,22) |
| InChIKey | UNUOEUGIBTXLEQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|